![](data:image/svg+xml;utf8,<svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" viewBox="0 0 72 71" width="72"></svg>)
For example, how to simplify trigonometric functions such as Tan (α - 3 π) and sin (α - 3 π)
Using the formula
tan(A-B)=(tanA-tanB)/(1+tanAtanB)
sin(A-B)=sinAcosB-sinBcosA
RELATED INFORMATIONS
- 1. If Tan α = 12, then (sin α + cos α) 2cos2 α=______ ．
- 2. If Tan α = 2, then the value of (sin α + cos α) ^ 2 / Cos2 α is
- 3. Find cos π / 5 times Cos2 π / 5 times cos3 π / 5 times Cos4 π / 5
- 4. How to calculate cos π / 9 * Cos2 π / 9 * Cos4 π / 9?
- 5. It is proved that sin (α + β) + 2cos (α - β) cos α cos β = Cos2 α + Cos2 β
- 6. cos2(a-π/3)=2cos^2(a-π/3)-1?
- 7. Derivation of Cos2 α = 2cos ^ 2 α - 1
- 8. sin^22θ+2cos^2θcos2θ=2cos^2θ
- 9. Evaluation cos faction / 7 * Cos2 faction / 7 * cos3 / 7 faction who will help do the next 3Q
- 10. It is proved that for any angle α, cos ^ 4 α - Sin ^ 4 α = cos 2 α by synthesis or analysis Mathematics is proved by synthesis or analysis: for any angle α, cos ^ 4 α - Sin ^ 4 α = Cos2 α It's better to use the inverse method
- 11. Simplification of 2tanx + Tan (π / 2-x) by trigonometric function of higher one How to simplify, the problem is to find the minimum If Tan = t So 2T ^ 2 + 1 / T = if we change the above into binary [2 (T + radical 2 / 2) ^ 2-1] / T It should be the smallest when t = 0, But the denominator is t How to find the minimum?
- 12. Simplification of trigonometric function Tan (tan-1 (8 / 6) / 2) Tan-1 means arc tan That is to say, Tan times 1 / 2 (arc tan4 / 3) How to simplify, teach me five Sorry, 0.5 was pressed by my computer
- 13. The value of reduced trigonometric ratio cos2a + Tan 2A. Cos2a
- 14. Why is sin20 transformed into (sin10) ^ 2
- 15. Fill in the brackets with a real number so that the equation 1 − & nbsp; & nbsp;) cos10 ° sin20 ° sin10 ° cos20 ° = 2 holds. The real number is______ ．
- 16. Given vector a = (1,2), vector b = (- 2, n), the angle between vector a and B is 45 ° (1) find B (2) if C and B are in the same direction, and C-A ⊥ a, find C
- 17. Given the vector a = (1,2), the vector b = (- 2, n), the angle between the vectors a and B is 45 °, find the vector B. if the vectors C and B are in the same direction, C-A ⊥ a, find C
- 18. It is known that vector a = (1,2), vector b = (- 2, n) and the angle between vector a and B is 45 degrees (1) Finding the vector b (2) If the vector C and B are in the same direction, and C-A is perpendicular to a, find C
- 19. The vector a = (1,2) B = (- 2, n) is known. The angle between a and B is 45 degrees
- 20. cos25°*cos(α-25°)-cos65°*sin(α-25°)