How to write the synthetic equation of aspirin I just don't know how to write that equation. I know what it's going to be like and what it's going to be like, but I don't know how to write it

The alcoholysis reaction of acetic anhydride and acetylsalicylic acid (o-hydroxybenzoic acid) means that the hydroxyl group on acetyl anhydride and acetylsalicylic acid reacts to form ester. If you write the equation yourself, it's too troublesome to write on it. I'm sorry

The formula of synthesizing aspirin
How to make aspirin from salicylic acid and acetic anhydride?
What is the chemical equation?

C7h6o3 (salicylic acid, 2-hydroxybenzoic acid) + (ch3co) 20 (acetic anhydride)
C9h8o4 (acetylsalicylic acid, aspirin)
Because of the acetylation of phenol hydroxyl, acid anhydride should be used instead of acid

Chemical equation for preparation of aspirin

Raw material salicylic acid (o-acetylphenol) + acetic anhydride, sulfuric acid catalysis, 70-75 ℃ heating, 1. Preparation of aspirin crude product, put the weighed salicylic acid and acetic anhydride into a dry conical flask, and drop five drops of concentrated sulfuric acid, gently shake the conical flask to dissolve the solid, and heat it in a water bath of 80 ℃ - 90 ℃ for about 15 minutes

Please help me to summarize the chemical equation of "different amount of reactants leads to different products" in high school chemistry!
Summarize the chemical equation of "different amount of reactants leads to different products" in senior high school chemistry! The more complete the better,

1、 Reaction of NaOH with AlCl3
a few:
Chemical equation: 3naoh + AlCl3 = = 3nacl + Al (OH) 3 ↓
Ion equation: 3OH - + Al3 + = = Al (OH) 3 ↓
overdose:
Chemical equation 4naoh + AlCl3 = = NaAlO2 + 3nacl + 2H2O
Ion equation: 4OH - + Al3 + = = AlO2 - + 2H2O
2、 Reaction of NaHCO3 with Ca (OH) 2
NaHCO3 small amount:
Chemical equation: NaHCO3 + Ca (OH) 2 = = CaCO3 ↓ + NaOH + H2O
Ion equation: HCO3 - + Ca2 + + OH - = = CaCO3 ↓ + H2O
NaHCO3 excess:
Chemical equation: 2nahco3 + Ca (OH) 2 = = CaCO3 ↓ + Na2CO3 + 2H2O
Ion equation: 2hco3 - + Ca2 + + 2OH - = = CaCO3 ↓ + + CO32 - + 2H2O
3、 Reaction of NaOH with CO2
Sufficient NaOH reacts with CO2: 2naoh + CO2 = Na2CO3 + H2O
NaOH reacts with excess CO2: 2naoh + CO2 = Na2CO3 + H2O, Na2CO3 + CO2 + H2O = 2nahco3
4、 C and O2 reaction
C + O2 = CO2 (sufficient O2)
2C + O2 = 2Co (insufficient O2)
5、 Reaction of Ca (OH) 2 with CO2
Ca (OH) 2 + CO2 = CaCO3 ↓ + H2O (sufficient CO2)
Ca (OH) 2 + 2co2 = Ca (HCO3) 2 (excessive CO2)
It can be summarized as follows:
① The product can continue to react with the excess substance
For this kind of ion reaction, we only need to pay attention to the given conditions, judge whether the product continues to react with the excess substance, and correctly determine the form of the product
For example: NaOH and AlCl3 solution (sufficient or insufficient); NaAlO2 solution is filled with CO2 (small or sufficient) or hydrochloric acid (small or sufficient); Ca (OH) 2 solution is filled with CO2 (small or sufficient); NaAlO2 solution is filled with hydrochloric acid (small or excessive). Another example is the reaction of carbon dioxide and sodium hydroxide. When they are 1:2, sodium carbonate and water are formed; when they are 1:1, sodium bicarbonate is formed, If the ratio is between the two, the products are sodium carbonate, sodium bicarbonate and water. There are also H2S, SO2 (equivalent to binary weak acid substances) similar to them
② The amount dependent ionic reaction of acid salts
In general, when writing, the ratio of the amount of the insufficient substance to the amount of the ion participating in the reaction must be consistent with its chemical formula, while the ratio of the amount of the sufficient substance to the amount of the ion participating in the reaction may not be consistent with its chemical formula. If there is no definite amount, the ion equation written with any reactant as the sufficient amount is correct
For example: NaHSO4 solution and BA (HCO3) 2 solution (small amount or sufficient amount); Ca (HCO3) 2 solution and NaOH solution (small amount or sufficient amount); Ca (OH) 2 and NaHCO3 solution (unlimited amount); NaH2PO4 solution and BA (OH) 2 solution (small amount or sufficient amount), the effect of dosage should be clear
③ A special and quantity dependent ionic reaction
This kind of reaction requires an overall consideration with other factors
For example, Mg (HCO3) 2 solution reacts with excess NaOH solution;
Alum reacts with sufficient BA (OH) 2 solution;
NH4HSO4 solution reacts with BA (OH) 2 solution;
The new chlorine water reacts with a small amount of febr2 solution;
FeCl3 + Zn - (the reaction of FeCl3 solution with more active metal such as zinc, the product is different according to the amount of zinc. For example, a small amount or an appropriate amount of zinc is oxidized to form Zn2 +, and Fe3 + is reduced to Fe2 +. Zn + 2fe3 + = = Zn2 + + 2fe2+
For example, in case of excessive zinc, on the basis of the above reaction, the remaining zinc and Fe2 + take place displacement reaction. The general chemical equation is: 3zn (excessive) + 2fe3 + = = 3zn2 + + 2Fe)
In addition, when metal reacts with nitric acid, the amount of iron is different, and the reaction products are also different

How to write the chemical reaction equation of isoprene and bromine in the ratio of 1:1

1,2 addition:
CH2C(CH3)CHCH2+Br2=CH2BrCBr(CH3)CHCH2
3,4 addition:
CH2C(CH3)CHCH2+Br2==CH2C(CH3)CHBrCH2Br
1,4 addition:
CH2C(CH3)CHCH2+Br2==CH2BrC(CH3)CHCH2Br
It may also be added with hypobromic acid in bromine water

What determines the power of the concentration of the amount of substance in the chemical reaction rate equation
Because our teacher had an intermediate reaction, it was decided by that, but he didn't understand

It can be divided into two types: meta reaction and general reaction
The power of the total reaction can not be determined by the reaction formula alone, but the power of the concentration of the amount of the material in the elementary reaction is equal to the corresponding coefficient of the reactant, for example: a + 2B = C. if it is a total reaction, the power must be determined by experiment, and the direct power of the elementary reaction is v = kcacb ^ 2

Quantitative chemical reaction equation of substances
In order to increase the mass fraction of solute in 100g 9.32% NaOH solution to 20%, how many grams of sodium metal should be added to the solution?

2Na + 2H2O = 2NaOH + H2↑
Shejia metal sodium XG
Then hydrogen is produced X / 23 G
The original solution contains sodium 100 * 9.32% * 23 / 40 = 5.359g
359 + x) g
5.359+x=（100+x-x/23）*20%
The solution is x = 18.1

TNT reaction equation of toluene formation

CH3 (C6H5) + 3hno3 = = > CH3 (c6h2) (NO2) 3 meta + 3H2O

How to write the synthetic equation of aspirin I just don't know how to write that equation. I know what it's going to be like and what it's going to be like, but I don't know how to write it