Thank you very much
1, CD is the hypotenuse of RT △ ABC, the height on BC is known as AC = 4cm, BD = 6cm, then BC =? 2, the three sides of triangle are a, B, C, the height on each side are ha, Hb, HC, if a: B: C = 3:6:5, then ha: HB: HC=_______ In quadrilateral ABCD, ab = CD, ∠ B = D
Several chemical reaction equations in Senior High School
3. Heat copper nitrate hydrate to 400 ℃
Reaction of Cu2O with dilute nitric acid
Phosphoric acid reacts with NaOH in the ratio of 2:3
Cu(NO3)2.3H2O=CuO+3H2O+2NO2↑
3cu2o + dilute 14hno3 = 6cu (NO3) 2 + 2No ↑ + 7H2O
2H3PO4+3NaOH=NaH2PO4+Na2HPO4+3H2O
Chemical equation for the reaction of aspirin with NaOH
Aspirin & nbsp; + & nbsp; 3naoh & nbsp; = = = sodium ortho carboxylate and sodium phenolate & nbsp; + & nbsp; + & nbsp; & nbsp; sodium acetate & nbsp; + & nbsp; & nbsp; 2H2O (aspirin on the left and sodium ortho carboxylate and sodium phenolate on the right) is also possible. In the structure of aspirin & nbsp; only carboxyl group reacts with sodium hydroxide, only acid-base neutralization
Chemical equation of aspirin modification
Why does aspirin have to be sealed and stored dry?
The reaction type belongs to?
Aspirin is mainly acetylsalicylic acid, which is hydrolyzed to produce salicylic acid and acetic acid. Salicylic acid is easy to oxidize and gradually turns to light yellow, red brown or even dark brown in air. It changes faster in aqueous solution, so it needs to be dried
The type of reaction is hydrolysis